About CID 90811860
CID 90811860 (PubChem CID 90811860) has the molecular formula C6H2N3S3
and a molecular weight of 212.30 g/mol.
Molecular Properties
| Compound Name | CID 90811860 |
| PubChem CID | 90811860 |
| Molecular Formula | C6H2N3S3 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 211.94 |
| IUPAC Name | — |
| SMILES | c1c2c(cc3nsnc13)S[N]S2 |
| InChI | InChI=1S/C6H2N3S3/c1-3-4(8-12-7-3)2-6-5(1)10-9-11-6/h1-2H |
| InChIKey | NJWRNWQFLGOGGM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 90811860 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90811860?
The IUPAC name of CID 90811860 (CID 90811860) is not available.
What is the SMILES notation for CID 90811860?
The canonical SMILES for CID 90811860 is c1c2c(cc3nsnc13)S[N]S2.
What is the InChIKey of CID 90811860?
The InChIKey is NJWRNWQFLGOGGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N3S3/c1-3-4(8-12-7-3)2-6-5(1)10-9-11-6/h1-2H.
What are the key properties of CID 90811860?
CID 90811860 has a molecular weight of 212.30 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90811860 is sourced from PubChem (CID 90811860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).