About trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one
trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one (PubChem CID 90811888) has the molecular formula C16H30O3Si
and a molecular weight of 298.50 g/mol. Its IUPAC name is trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one |
| PubChem CID | 90811888 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one |
| SMILES | CCCC=C1[C@H](O)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-7-8-9-13-14(18)10-12(17)11-15(13)19-20(5,6)16(2,3)4/h9,14-15,18H,7-8,10-11H2,1-6H3/t14-,15-/m1/s1 |
| InChIKey | ONRZJOJDRZOTHY-HUUCEWRRSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one?
The IUPAC name of trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one (CID 90811888) is trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one.
What is the SMILES notation for trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one?
The canonical SMILES for trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one is CCCC=C1[C@H](O)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one?
The InChIKey is ONRZJOJDRZOTHY-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H30O3Si/c1-7-8-9-13-14(18)10-12(17)11-15(13)19-20(5,6)16(2,3)4/h9,14-15,18H,7-8,10-11H2,1-6H3/t14-,15-/m1/s1.
What are the key properties of trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one?
trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one has a molecular weight of 298.50 g/mol, XLogP of 3.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one is sourced from PubChem (CID 90811888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).