C43H35FN4S2 — CID 90811894
3-(5-butylsulfanylthiophen-2-yl)-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine (PubChem CID 90811894) has the molecular formula C43H35FN4S2 and a molecular weight of 690.91 g/mol. Its IUPAC name is 3-(5-butylsulfanylthiophen-2-yl)-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine.
| Compound Name | 3-(5-butylsulfanylthiophen-2-yl)-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 90811894 |
| Molecular Formula | C43H35FN4S2 |
| Molecular Weight | 690.91 g/mol |
| Exact Mass | 690.23 |
| IUPAC Name | 3-(5-butylsulfanylthiophen-2-yl)-6-[3-(4-fluorophenyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridine |
| SMILES | CCCCSc1ccc(-c2cnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(F)cc4)cn23)s1 |
| InChI | InChI=1S/C43H35FN4S2/c1-2-3-27-49-41-26-24-39(50-41)38-28-45-40-25-21-32(29-47(38)40)37-30-48(46-42(37)31-19-22-36(44)23-20-31)43(33-13-7-4-8-14-33,34-15-9-5-10-16-34)35-17-11-6-12-18-35/h4-26,28-30H,2-3,27H2,1H3 |
| InChIKey | ZECFYJHCRISMTG-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.91 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|