About 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine
1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine (PubChem CID 90811992) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine.
Molecular Properties
| Compound Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine |
| PubChem CID | 90811992 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine |
| SMILES | CC1CCN(CC2=CCC=C2)CC1 |
| InChI | InChI=1S/C12H19N/c1-11-6-8-13(9-7-11)10-12-4-2-3-5-12/h2,4-5,11H,3,6-10H2,1H3 |
| InChIKey | ULFHFNSTCLUELY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine?
The IUPAC name of 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine (CID 90811992) is 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine.
What is the SMILES notation for 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine?
The canonical SMILES for 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine is CC1CCN(CC2=CCC=C2)CC1.
What is the InChIKey of 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine?
The InChIKey is ULFHFNSTCLUELY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-11-6-8-13(9-7-11)10-12-4-2-3-5-12/h2,4-5,11H,3,6-10H2,1H3.
What are the key properties of 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine?
1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine has a molecular weight of 177.29 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopenta-1,4-dien-1-ylmethyl)-4-methylpiperidine is sourced from PubChem (CID 90811992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).