C12H14N2O6 — CID 90812030
2,6-dimethoxy-4,8-dihydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrol (PubChem CID 90812030) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 2,6-dimethoxy-4,8-dihydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrol.
| Compound Name | 2,6-dimethoxy-4,8-dihydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrol |
|---|---|
| PubChem CID | 90812030 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2,6-dimethoxy-4,8-dihydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrol |
| SMILES | COn1c(O)c2c(c1O)Cc1c(c(O)n(OC)c1O)C2 |
| InChI | InChI=1S/C12H14N2O6/c1-19-13-9(15)5-3-7-8(4-6(5)10(13)16)12(18)14(20-2)11(7)17/h15-18H,3-4H2,1-2H3 |
| InChIKey | KEOKJJZEQOWBKE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |