C17H16N4O3 — CID 9081256
N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-4-pyrazol-1-ylbenzamide (PubChem CID 9081256) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-4-pyrazol-1-ylbenzamide.
| Compound Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-4-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 9081256 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-4-pyrazol-1-ylbenzamide |
| SMILES | O=C(CNC(=O)c1ccc(-n2cccn2)cc1)NCc1ccco1 |
| InChI | InChI=1S/C17H16N4O3/c22-16(18-11-15-3-1-10-24-15)12-19-17(23)13-4-6-14(7-5-13)21-9-2-8-20-21/h1-10H,11-12H2,(H,18,22)(H,19,23) |
| InChIKey | NYQIEMZSAXVDID-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |