C22H39NO — CID 90812808
2-methyl-7-(2,2,5,5-tetramethylcyclodecyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole (PubChem CID 90812808) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is 2-methyl-7-(2,2,5,5-tetramethylcyclodecyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole.
| Compound Name | 2-methyl-7-(2,2,5,5-tetramethylcyclodecyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 90812808 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | 2-methyl-7-(2,2,5,5-tetramethylcyclodecyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole |
| SMILES | CC1=NC2CCCC(C3CCCCCC(C)(C)CCC3(C)C)C2O1 |
| InChI | InChI=1S/C22H39NO/c1-16-23-19-12-9-10-17(20(19)24-16)18-11-7-6-8-13-21(2,3)14-15-22(18,4)5/h17-20H,6-15H2,1-5H3 |
| InChIKey | VXQQGXVNRDDRRU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |