C20H33BNO2 — CID 90812906
CID 90812906 (PubChem CID 90812906) has the molecular formula C20H33BNO2 and a molecular weight of 330.30 g/mol.
| Compound Name | CID 90812906 |
|---|---|
| PubChem CID | 90812906 |
| Molecular Formula | C20H33BNO2 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(C)(C)O[B]c1cccc(OCCCN2CCCC2)c1 |
| InChI | InChI=1S/C20H33BNO2/c1-19(2,3)20(4,5)24-21-17-10-8-11-18(16-17)23-15-9-14-22-12-6-7-13-22/h8,10-11,16H,6-7,9,12-15H2,1-5H3 |
| InChIKey | REYUOMJOKCHYSU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|