C18H13F3N2O4 — CID 90812966
(1R,7R,8S,10R)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-triene-3,5-diol (PubChem CID 90812966) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is (1R,7R,8S,10R)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-triene-3,5-diol.
| Compound Name | (1R,7R,8S,10R)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-triene-3,5-diol |
|---|---|
| PubChem CID | 90812966 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (1R,7R,8S,10R)-4-[4-nitro-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-triene-3,5-diol |
| SMILES | O=[N+]([O-])c1ccc(-n2c(O)c3c(c2O)[C@@H]2C=C[C@@H]3[C@@H]3C[C@@H]32)cc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O4/c19-18(20,21)12-5-7(1-4-13(12)23(26)27)22-16(24)14-8-2-3-9(11-6-10(8)11)15(14)17(22)25/h1-5,8-11,24-25H,6H2/t8-,9-,10-,11+/m1/s1 |
| InChIKey | DNYQSKIESBSXEY-DBIOUOCHSA-N |
| XLogP | 4.20 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|