About ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one
ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one (PubChem CID 90813857) has the molecular formula C19H37NO4
and a molecular weight of 343.51 g/mol. Its IUPAC name is ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one.
Molecular Properties
| Compound Name | ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one |
| PubChem CID | 90813857 |
| Molecular Formula | C19H37NO4 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one |
| SMILES | CC.CC.CC.CC(=O)CCCCN1C(=O)C=CC1=O.CC(C)=O |
| InChI | InChI=1S/C10H13NO3.C3H6O.3C2H6/c1-8(12)4-2-3-7-11-9(13)5-6-10(11)14;1-3(2)4;3*1-2/h5-6H,2-4,7H2,1H3;1-2H3;3*1-2H3 |
| InChIKey | DWQXUQYIOCUMQM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one?
The IUPAC name of ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one (CID 90813857) is ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one.
What is the SMILES notation for ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one?
The canonical SMILES for ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one is CC.CC.CC.CC(=O)CCCCN1C(=O)C=CC1=O.CC(C)=O.
What is the InChIKey of ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one?
The InChIKey is DWQXUQYIOCUMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3.C3H6O.3C2H6/c1-8(12)4-2-3-7-11-9(13)5-6-10(11)14;1-3(2)4;3*1-2/h5-6H,2-4,7H2,1H3;1-2H3;3*1-2H3.
What are the key properties of ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one?
ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one has a molecular weight of 343.51 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(5-oxohexyl)pyrrole-2,5-dione;propan-2-one is sourced from PubChem (CID 90813857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).