C20H17BrN4O3 — CID 90814022
6-bromo-3-(1H-indazole-5-carbonyl)spiro[1,3-benzoxazine-2,4'-piperidine]-4-one (PubChem CID 90814022) has the molecular formula C20H17BrN4O3 and a molecular weight of 441.29 g/mol. Its IUPAC name is 6-bromo-3-(1H-indazole-5-carbonyl)spiro[1,3-benzoxazine-2,4'-piperidine]-4-one.
| Compound Name | 6-bromo-3-(1H-indazole-5-carbonyl)spiro[1,3-benzoxazine-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 90814022 |
| Molecular Formula | C20H17BrN4O3 |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 6-bromo-3-(1H-indazole-5-carbonyl)spiro[1,3-benzoxazine-2,4'-piperidine]-4-one |
| SMILES | O=C(c1ccc2[nH]ncc2c1)N1C(=O)c2cc(Br)ccc2OC12CCNCC2 |
| InChI | InChI=1S/C20H17BrN4O3/c21-14-2-4-17-15(10-14)19(27)25(20(28-17)5-7-22-8-6-20)18(26)12-1-3-16-13(9-12)11-23-24-16/h1-4,9-11,22H,5-8H2,(H,23,24) |
| InChIKey | FPAWCYRYWYWMRD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|