C21H26N4O4 — CID 90814077
7-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)-2,2-dimethylheptanoic acid (PubChem CID 90814077) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 7-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)-2,2-dimethylheptanoic acid.
| Compound Name | 7-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 90814077 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 7-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)-2,2-dimethylheptanoic acid |
| SMILES | Cc1cc2nc3[nH]c(=O)n(CCCCCC(C)(C)C(=O)O)c(=O)c3nc2cc1C |
| InChI | InChI=1S/C21H26N4O4/c1-12-10-14-15(11-13(12)2)23-17-16(22-14)18(26)25(20(29)24-17)9-7-5-6-8-21(3,4)19(27)28/h10-11H,5-9H2,1-4H3,(H,27,28)(H,23,24,29) |
| InChIKey | DEXYEPDAZAESGG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|