C25H20ClN5OS2 — CID 90814370
(5S)-5-[4-[(2S)-2-(1,3-benzothiazol-2-ylamino)-2-(6-chloro-1H-benzimidazol-2-yl)ethyl]phenyl]-1,2-thiazolidin-3-one (PubChem CID 90814370) has the molecular formula C25H20ClN5OS2 and a molecular weight of 506.06 g/mol. Its IUPAC name is (5S)-5-[4-[(2S)-2-(1,3-benzothiazol-2-ylamino)-2-(6-chloro-1H-benzimidazol-2-yl)ethyl]phenyl]-1,2-thiazolidin-3-one.
| Compound Name | (5S)-5-[4-[(2S)-2-(1,3-benzothiazol-2-ylamino)-2-(6-chloro-1H-benzimidazol-2-yl)ethyl]phenyl]-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 90814370 |
| Molecular Formula | C25H20ClN5OS2 |
| Molecular Weight | 506.06 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | (5S)-5-[4-[(2S)-2-(1,3-benzothiazol-2-ylamino)-2-(6-chloro-1H-benzimidazol-2-yl)ethyl]phenyl]-1,2-thiazolidin-3-one |
| SMILES | O=C1C[C@@H](c2ccc(C[C@H](Nc3nc4ccccc4s3)c3nc4ccc(Cl)cc4[nH]3)cc2)SN1 |
| InChI | InChI=1S/C25H20ClN5OS2/c26-16-9-10-17-19(12-16)28-24(27-17)20(30-25-29-18-3-1-2-4-21(18)33-25)11-14-5-7-15(8-6-14)22-13-23(32)31-34-22/h1-10,12,20,22H,11,13H2,(H,27,28)(H,29,30)(H,31,32)/t20-,22-/m0/s1 |
| InChIKey | JKWXRWOLJVWSPA-UNMCSNQZSA-N |
| XLogP | 6.43 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.06 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|