C18H38O5Si2 — CID 90814372
(6aR,8S,9aR)-8-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol (PubChem CID 90814372) has the molecular formula C18H38O5Si2 and a molecular weight of 390.67 g/mol. Its IUPAC name is (6aR,8S,9aR)-8-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol.
| Compound Name | (6aR,8S,9aR)-8-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
|---|---|
| PubChem CID | 90814372 |
| Molecular Formula | C18H38O5Si2 |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (6aR,8S,9aR)-8-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](C)C(O)[C@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C18H38O5Si2/c1-11(2)24(12(3)4)20-10-16-18(17(19)15(9)21-16)22-25(23-24,13(5)6)14(7)8/h11-19H,10H2,1-9H3/t15-,16+,17?,18-/m0/s1 |
| InChIKey | HRYRSFVPZFEOIE-WFFDWFOESA-N |
| XLogP | 4.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|