C18H20F3NO5 — CID 90814873
[5-(1,7-dioxa-2-azaspiro[4.4]non-3-en-3-yl)-2-(2,2,2-trifluoroethoxy)phenyl] butanoate (PubChem CID 90814873) has the molecular formula C18H20F3NO5 and a molecular weight of 387.35 g/mol. Its IUPAC name is [5-(1,7-dioxa-2-azaspiro[4.4]non-3-en-3-yl)-2-(2,2,2-trifluoroethoxy)phenyl] butanoate.
| Compound Name | [5-(1,7-dioxa-2-azaspiro[4.4]non-3-en-3-yl)-2-(2,2,2-trifluoroethoxy)phenyl] butanoate |
|---|---|
| PubChem CID | 90814873 |
| Molecular Formula | C18H20F3NO5 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [5-(1,7-dioxa-2-azaspiro[4.4]non-3-en-3-yl)-2-(2,2,2-trifluoroethoxy)phenyl] butanoate |
| SMILES | CCCC(=O)Oc1cc(C2=CC3(CCOC3)ON2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C18H20F3NO5/c1-2-3-16(23)26-15-8-12(4-5-14(15)25-11-18(19,20)21)13-9-17(27-22-13)6-7-24-10-17/h4-5,8-9,22H,2-3,6-7,10-11H2,1H3 |
| InChIKey | KSNCQLSVAFGJGK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|