About 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine
2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 90815843) has the molecular formula C8H10N2S
and a molecular weight of 166.25 g/mol. Its IUPAC name is 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
Molecular Properties
| Compound Name | 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| PubChem CID | 90815843 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | CSc1ncc2c(n1)CCC2 |
| InChI | InChI=1S/C8H10N2S/c1-11-8-9-5-6-3-2-4-7(6)10-8/h5H,2-4H2,1H3 |
| InChIKey | IFQZZMKLFMUHRW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The IUPAC name of 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (CID 90815843) is 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
What is the SMILES notation for 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The canonical SMILES for 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine is CSc1ncc2c(n1)CCC2.
What is the InChIKey of 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The InChIKey is IFQZZMKLFMUHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S/c1-11-8-9-5-6-3-2-4-7(6)10-8/h5H,2-4H2,1H3.
What are the key properties of 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine has a molecular weight of 166.25 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine is sourced from PubChem (CID 90815843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).