C24H18N2O4 — CID 90815989
4-hydroxy-5-[(1R)-6-(4-isocyanonaphthalen-1-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3H-1,3-oxazol-2-one (PubChem CID 90815989) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-hydroxy-5-[(1R)-6-(4-isocyanonaphthalen-1-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3H-1,3-oxazol-2-one.
| Compound Name | 4-hydroxy-5-[(1R)-6-(4-isocyanonaphthalen-1-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 90815989 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-hydroxy-5-[(1R)-6-(4-isocyanonaphthalen-1-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl]-3H-1,3-oxazol-2-one |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc3c(c2)CCC[C@H]3c2oc(=O)[nH]c2O)c2ccccc12 |
| InChI | InChI=1S/C24H18N2O4/c1-25-20-11-12-21(18-7-3-2-6-17(18)20)29-15-9-10-16-14(13-15)5-4-8-19(16)22-23(27)26-24(28)30-22/h2-3,6-7,9-13,19,27H,4-5,8H2,(H,26,28)/t19-/m1/s1 |
| InChIKey | AVMWUGYXHFENPL-LJQANCHMSA-N |
| XLogP | 5.64 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|