About 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran
3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran (PubChem CID 90816353) has the molecular formula C17H15FOS
and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran |
| PubChem CID | 90816353 |
| Molecular Formula | C17H15FOS |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran |
| SMILES | Cc1cc(C)c2c(Sc3ccc(F)cc3)c(C)oc2c1 |
| InChI | InChI=1S/C17H15FOS/c1-10-8-11(2)16-15(9-10)19-12(3)17(16)20-14-6-4-13(18)5-7-14/h4-9H,1-3H3 |
| InChIKey | WFSCIWCDNNTSOP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran?
The IUPAC name of 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran (CID 90816353) is 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran.
What is the SMILES notation for 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran?
The canonical SMILES for 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran is Cc1cc(C)c2c(Sc3ccc(F)cc3)c(C)oc2c1.
What is the InChIKey of 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran?
The InChIKey is WFSCIWCDNNTSOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FOS/c1-10-8-11(2)16-15(9-10)19-12(3)17(16)20-14-6-4-13(18)5-7-14/h4-9H,1-3H3.
What are the key properties of 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran?
3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran has a molecular weight of 286.37 g/mol, XLogP of 5.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)sulfanyl-2,4,6-trimethyl-1-benzofuran is sourced from PubChem (CID 90816353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).