C9H17N3 — CID 90816537
1-methyl-5-methylidene-3,3a,4,6,7,7a-hexahydro-2H-indazol-3-amine (PubChem CID 90816537) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-methyl-5-methylidene-3,3a,4,6,7,7a-hexahydro-2H-indazol-3-amine.
| Compound Name | 1-methyl-5-methylidene-3,3a,4,6,7,7a-hexahydro-2H-indazol-3-amine |
|---|---|
| PubChem CID | 90816537 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-methyl-5-methylidene-3,3a,4,6,7,7a-hexahydro-2H-indazol-3-amine |
| SMILES | C=C1CCC2C(C1)C(N)NN2C |
| InChI | InChI=1S/C9H17N3/c1-6-3-4-8-7(5-6)9(10)11-12(8)2/h7-9,11H,1,3-5,10H2,2H3 |
| InChIKey | DEPHXCAALKCIOY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|