C32H42F6O6 — CID 90816542
1-butan-2-yl-4-tert-butylbenzene;1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 90816542) has the molecular formula C32H42F6O6 and a molecular weight of 636.67 g/mol. Its IUPAC name is 1-butan-2-yl-4-tert-butylbenzene;1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | 1-butan-2-yl-4-tert-butylbenzene;1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 90816542 |
| Molecular Formula | C32H42F6O6 |
| Molecular Weight | 636.67 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | 1-butan-2-yl-4-tert-butylbenzene;1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1C2CC3C1OC(=O)C3(C(=O)OC(C(F)(F)F)C(F)(F)F)C2.CCC(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H20F6O6.C14H22/c1-4-15(2,3)12(25)28-9-7-5-8-10(9)29-13(26)16(8,6-7)14(27)30-11(17(19,20)21)18(22,23)24;1-6-11(2)12-7-9-13(10-8-12)14(3,4)5/h7-11H,4-6H2,1-3H3;7-11H,6H2,1-5H3 |
| InChIKey | COMYKMFXKZBGOM-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.67 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|