C25H26F3NO2 — CID 90816549
(3R,3aS,4S,5R,6S,7aR)-3,5,6-trimethyl-4-[2-[5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 90816549) has the molecular formula C25H26F3NO2 and a molecular weight of 429.48 g/mol. Its IUPAC name is (3R,3aS,4S,5R,6S,7aR)-3,5,6-trimethyl-4-[2-[5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,5R,6S,7aR)-3,5,6-trimethyl-4-[2-[5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 90816549 |
| Molecular Formula | C25H26F3NO2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (3R,3aS,4S,5R,6S,7aR)-3,5,6-trimethyl-4-[2-[5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | C[C@H]1[C@H](C=Cc2ccc(-c3cccc(C(F)(F)F)c3)cn2)[C@@H]2[C@@H](C)OC(=O)[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C25H26F3NO2/c1-14-11-22-23(16(3)31-24(22)30)21(15(14)2)10-9-20-8-7-18(13-29-20)17-5-4-6-19(12-17)25(26,27)28/h4-10,12-16,21-23H,11H2,1-3H3/t14-,15+,16+,21-,22+,23-/m0/s1 |
| InChIKey | KWKUQIMAYOLOSG-MLPPYJGZSA-N |
| XLogP | 6.25 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |