C25H29F3N4O3S — CID 90816785
4-[7-[1-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dihydroxy-4-methylpyrrol-3-yl]hept-6-enyl]piperazine-1-carbothioic S-acid (PubChem CID 90816785) has the molecular formula C25H29F3N4O3S and a molecular weight of 522.59 g/mol. Its IUPAC name is 4-[7-[1-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dihydroxy-4-methylpyrrol-3-yl]hept-6-enyl]piperazine-1-carbothioic S-acid.
| Compound Name | 4-[7-[1-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dihydroxy-4-methylpyrrol-3-yl]hept-6-enyl]piperazine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 90816785 |
| Molecular Formula | C25H29F3N4O3S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 4-[7-[1-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dihydroxy-4-methylpyrrol-3-yl]hept-6-enyl]piperazine-1-carbothioic S-acid |
| SMILES | Cc1c(C=CCCCCCN2CCN(C(=O)S)CC2)c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C25H29F3N4O3S/c1-17-20(7-5-3-2-4-6-10-30-11-13-31(14-12-30)24(35)36)23(34)32(22(17)33)19-9-8-18(16-29)21(15-19)25(26,27)28/h5,7-9,15,33-34H,2-4,6,10-14H2,1H3,(H,35,36) |
| InChIKey | HUEWDCPUQOZSDF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|