About (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol
(6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol (PubChem CID 90816798) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol |
| PubChem CID | 90816798 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol |
| SMILES | C/N=C1\C=CC(CO)CC(C)=C1 |
| InChI | InChI=1S/C10H15NO/c1-8-5-9(7-12)3-4-10(6-8)11-2/h3-4,6,9,12H,5,7H2,1-2H3/b11-10+ |
| InChIKey | YTPTWHBYEVJXNG-ZHACJKMWSA-N |
| XLogP | 1.57 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol?
The IUPAC name of (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol (CID 90816798) is (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol.
What is the SMILES notation for (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol?
The canonical SMILES for (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol is C/N=C1\C=CC(CO)CC(C)=C1.
What is the InChIKey of (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol?
The InChIKey is YTPTWHBYEVJXNG-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H15NO/c1-8-5-9(7-12)3-4-10(6-8)11-2/h3-4,6,9,12H,5,7H2,1-2H3/b11-10+.
What are the key properties of (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol?
(6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol has a molecular weight of 165.24 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-4-methyliminocyclohepta-2,5-dien-1-yl)methanol is sourced from PubChem (CID 90816798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).