C21H26F3N3O3 — CID 90817134
(1R,3R)-1-[5-(1H-indol-3-yl)-4-methyl-1,3-oxazol-2-yl]-N,3-dimethylpentan-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 90817134) has the molecular formula C21H26F3N3O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is (1R,3R)-1-[5-(1H-indol-3-yl)-4-methyl-1,3-oxazol-2-yl]-N,3-dimethylpentan-1-amine;2,2,2-trifluoroacetic acid.
| Compound Name | (1R,3R)-1-[5-(1H-indol-3-yl)-4-methyl-1,3-oxazol-2-yl]-N,3-dimethylpentan-1-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90817134 |
| Molecular Formula | C21H26F3N3O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (1R,3R)-1-[5-(1H-indol-3-yl)-4-methyl-1,3-oxazol-2-yl]-N,3-dimethylpentan-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H](C)C[C@@H](NC)c1nc(C)c(-c2c[nH]c3ccccc23)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N3O.C2HF3O2/c1-5-12(2)10-17(20-4)19-22-13(3)18(23-19)15-11-21-16-9-7-6-8-14(15)16;3-2(4,5)1(6)7/h6-9,11-12,17,20-21H,5,10H2,1-4H3;(H,6,7)/t12-,17-;/m1./s1 |
| InChIKey | LNAMKPMDPYLGGY-JSUROZADSA-N |
| XLogP | 5.46 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |