C20H22N2O5 — CID 90817145
N-hydroxy-4-[(2R)-1-[3-(4-methoxyphenyl)prop-2-enoylamino]propan-2-yl]oxybenzamide (PubChem CID 90817145) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-hydroxy-4-[(2R)-1-[3-(4-methoxyphenyl)prop-2-enoylamino]propan-2-yl]oxybenzamide.
| Compound Name | N-hydroxy-4-[(2R)-1-[3-(4-methoxyphenyl)prop-2-enoylamino]propan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 90817145 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-hydroxy-4-[(2R)-1-[3-(4-methoxyphenyl)prop-2-enoylamino]propan-2-yl]oxybenzamide |
| SMILES | COc1ccc(C=CC(=O)NC[C@@H](C)Oc2ccc(C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-14(27-18-10-6-16(7-11-18)20(24)22-25)13-21-19(23)12-5-15-3-8-17(26-2)9-4-15/h3-12,14,25H,13H2,1-2H3,(H,21,23)(H,22,24)/t14-/m1/s1 |
| InChIKey | IKXCTLFKSHBKKD-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|