About 7-(methylsulfonylmethyl)-2,1-benzoxazole
7-(methylsulfonylmethyl)-2,1-benzoxazole (PubChem CID 90817262) has the molecular formula C9H9NO3S
and a molecular weight of 211.24 g/mol. Its IUPAC name is 7-(methylsulfonylmethyl)-2,1-benzoxazole.
Molecular Properties
| Compound Name | 7-(methylsulfonylmethyl)-2,1-benzoxazole |
| PubChem CID | 90817262 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 7-(methylsulfonylmethyl)-2,1-benzoxazole |
| SMILES | CS(=O)(=O)Cc1cccc2conc12 |
| InChI | InChI=1S/C9H9NO3S/c1-14(11,12)6-8-4-2-3-7-5-13-10-9(7)8/h2-5H,6H2,1H3 |
| InChIKey | CMEYGOWPYGDZSD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(methylsulfonylmethyl)-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(methylsulfonylmethyl)-2,1-benzoxazole?
The IUPAC name of 7-(methylsulfonylmethyl)-2,1-benzoxazole (CID 90817262) is 7-(methylsulfonylmethyl)-2,1-benzoxazole.
What is the SMILES notation for 7-(methylsulfonylmethyl)-2,1-benzoxazole?
The canonical SMILES for 7-(methylsulfonylmethyl)-2,1-benzoxazole is CS(=O)(=O)Cc1cccc2conc12.
What is the InChIKey of 7-(methylsulfonylmethyl)-2,1-benzoxazole?
The InChIKey is CMEYGOWPYGDZSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3S/c1-14(11,12)6-8-4-2-3-7-5-13-10-9(7)8/h2-5H,6H2,1H3.
What are the key properties of 7-(methylsulfonylmethyl)-2,1-benzoxazole?
7-(methylsulfonylmethyl)-2,1-benzoxazole has a molecular weight of 211.24 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(methylsulfonylmethyl)-2,1-benzoxazole is sourced from PubChem (CID 90817262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).