About 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid
2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid (PubChem CID 90817511) has the molecular formula C13H10ClF3N4O3
and a molecular weight of 362.70 g/mol. Its IUPAC name is 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid |
| PubChem CID | 90817511 |
| Molecular Formula | C13H10ClF3N4O3 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid |
| SMILES | Cc1nn(C)c(C(=O)Nc2cnc(Cl)c(C(=O)O)c2)c1C(F)(F)F |
| InChI | InChI=1S/C13H10ClF3N4O3/c1-5-8(13(15,16)17)9(21(2)20-5)11(22)19-6-3-7(12(23)24)10(14)18-4-6/h3-4H,1-2H3,(H,19,22)(H,23,24) |
| InChIKey | HNOZVURASQPDKP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid?
The IUPAC name of 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid (CID 90817511) is 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid?
The canonical SMILES for 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid is Cc1nn(C)c(C(=O)Nc2cnc(Cl)c(C(=O)O)c2)c1C(F)(F)F.
What is the InChIKey of 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid?
The InChIKey is HNOZVURASQPDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClF3N4O3/c1-5-8(13(15,16)17)9(21(2)20-5)11(22)19-6-3-7(12(23)24)10(14)18-4-6/h3-4H,1-2H3,(H,19,22)(H,23,24).
What are the key properties of 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid?
2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid has a molecular weight of 362.70 g/mol, XLogP of 2.75, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[[1,3-dimethyl-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylic acid is sourced from PubChem (CID 90817511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).