C28H30FN5O4 — CID 90817679
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(isocyanomethoxy)phenyl]ethyl]oxane-2,4-dione (PubChem CID 90817679) has the molecular formula C28H30FN5O4 and a molecular weight of 519.58 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(isocyanomethoxy)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(isocyanomethoxy)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 90817679 |
| Molecular Formula | C28H30FN5O4 |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-fluoro-4-(isocyanomethoxy)phenyl]ethyl]oxane-2,4-dione |
| SMILES | [C-]#[N+]COc1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)cc1F |
| InChI | InChI=1S/C28H30FN5O4/c1-17-12-18(2)34-27(31-17)32-25(33-34)14-21-23(35)15-28(38-26(21)36,20-6-4-5-7-20)11-10-19-8-9-24(22(29)13-19)37-16-30-3/h8-9,12-13,20-21H,4-7,10-11,14-16H2,1-2H3 |
| InChIKey | PXNRGPOWNDPSHH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 100.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|