C7H10O7 — CID 90817938
cis-(4S,5R)-2-(1,2-dihydroxyethyl)-2,4,5-trihydroxycyclopentane-1,3-dione (PubChem CID 90817938) has the molecular formula C7H10O7 and a molecular weight of 206.15 g/mol. Its IUPAC name is cis-(4S,5R)-2-(1,2-dihydroxyethyl)-2,4,5-trihydroxycyclopentane-1,3-dione.
| Compound Name | cis-(4S,5R)-2-(1,2-dihydroxyethyl)-2,4,5-trihydroxycyclopentane-1,3-dione |
|---|---|
| PubChem CID | 90817938 |
| Molecular Formula | C7H10O7 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | cis-(4S,5R)-2-(1,2-dihydroxyethyl)-2,4,5-trihydroxycyclopentane-1,3-dione |
| SMILES | O=C1[C@@H](O)[C@@H](O)C(=O)C1(O)C(O)CO |
| InChI | InChI=1S/C7H10O7/c8-1-2(9)7(14)5(12)3(10)4(11)6(7)13/h2-4,8-11,14H,1H2/t2?,3-,4+,7? |
| InChIKey | JBPWQOUNTIYKTP-VQFZUWLTSA-N |
| XLogP | -4.06 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|