About 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one
3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one (PubChem CID 90818144) has the molecular formula C19H28N2O2
and a molecular weight of 316.44 g/mol. Its IUPAC name is 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one.
Molecular Properties
| Compound Name | 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one |
| PubChem CID | 90818144 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one |
| SMILES | O=C(CC1CCCC1)C(O)(c1ccccc1)N1CCCNCC1 |
| InChI | InChI=1S/C19H28N2O2/c22-18(15-16-7-4-5-8-16)19(23,17-9-2-1-3-10-17)21-13-6-11-20-12-14-21/h1-3,9-10,16,20,23H,4-8,11-15H2 |
| InChIKey | XYPPCFADSPPZNC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one?
The IUPAC name of 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one (CID 90818144) is 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one.
What is the SMILES notation for 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one?
The canonical SMILES for 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one is O=C(CC1CCCC1)C(O)(c1ccccc1)N1CCCNCC1.
What is the InChIKey of 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one?
The InChIKey is XYPPCFADSPPZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O2/c22-18(15-16-7-4-5-8-16)19(23,17-9-2-1-3-10-17)21-13-6-11-20-12-14-21/h1-3,9-10,16,20,23H,4-8,11-15H2.
What are the key properties of 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one?
3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one has a molecular weight of 316.44 g/mol, XLogP of 2.28, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one is sourced from PubChem (CID 90818144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).