About ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride
ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride (PubChem CID 90818476) has the molecular formula C10H15ClF3NO2
and a molecular weight of 273.68 g/mol. Its IUPAC name is ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride.
Molecular Properties
| Compound Name | ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride |
| PubChem CID | 90818476 |
| Molecular Formula | C10H15ClF3NO2 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride |
| SMILES | CC.O=C(Cl)C1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H9ClF3NO2.C2H6/c9-6(14)5-1-3-13(4-2-5)7(15)8(10,11)12;1-2/h5H,1-4H2;1-2H3 |
| InChIKey | CBIQOXLPNPEWSU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride?
The IUPAC name of ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride (CID 90818476) is ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride.
What is the SMILES notation for ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride?
The canonical SMILES for ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride is CC.O=C(Cl)C1CCN(C(=O)C(F)(F)F)CC1.
What is the InChIKey of ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride?
The InChIKey is CBIQOXLPNPEWSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF3NO2.C2H6/c9-6(14)5-1-3-13(4-2-5)7(15)8(10,11)12;1-2/h5H,1-4H2;1-2H3.
What are the key properties of ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride?
ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride has a molecular weight of 273.68 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2,2,2-trifluoroacetyl)piperidine-4-carbonyl chloride is sourced from PubChem (CID 90818476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).