C22H27N5O13 — CID 90818597
(2,5-dihydroxypyrrol-1-yl) (2R,3R)-2,3-diacetyloxy-4-[[(1R,2R,4R,5R)-2,5-diacetyloxy-4-azidocyclohexyl]amino]-4-oxobutanoate (PubChem CID 90818597) has the molecular formula C22H27N5O13 and a molecular weight of 569.48 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2R,3R)-2,3-diacetyloxy-4-[[(1R,2R,4R,5R)-2,5-diacetyloxy-4-azidocyclohexyl]amino]-4-oxobutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2R,3R)-2,3-diacetyloxy-4-[[(1R,2R,4R,5R)-2,5-diacetyloxy-4-azidocyclohexyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 90818597 |
| Molecular Formula | C22H27N5O13 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2R,3R)-2,3-diacetyloxy-4-[[(1R,2R,4R,5R)-2,5-diacetyloxy-4-azidocyclohexyl]amino]-4-oxobutanoate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](NC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)On2c(O)ccc2O)[C@H](OC(C)=O)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C22H27N5O13/c1-9(28)36-15-8-14(25-26-23)16(37-10(2)29)7-13(15)24-21(34)19(38-11(3)30)20(39-12(4)31)22(35)40-27-17(32)5-6-18(27)33/h5-6,13-16,19-20,32-33H,7-8H2,1-4H3,(H,24,34)/t13-,14-,15-,16-,19-,20-/m1/s1 |
| InChIKey | OFRWYJDDDBHZQY-LYYPEUCTSA-N |
| XLogP | -0.46 |
| TPSA | 254.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|