About (5S,6S)-5-amino-6-methyloxane-2,5-diol
(5S,6S)-5-amino-6-methyloxane-2,5-diol (PubChem CID 90818771) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is (5S,6S)-5-amino-6-methyloxane-2,5-diol.
Molecular Properties
| Compound Name | (5S,6S)-5-amino-6-methyloxane-2,5-diol |
| PubChem CID | 90818771 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (5S,6S)-5-amino-6-methyloxane-2,5-diol |
| SMILES | C[C@@H]1OC(O)CC[C@]1(N)O |
| InChI | InChI=1S/C6H13NO3/c1-4-6(7,9)3-2-5(8)10-4/h4-5,8-9H,2-3,7H2,1H3/t4-,5?,6-/m0/s1 |
| InChIKey | UXELRRQCHHMYJQ-BZWZBFKDSA-N |
| XLogP | -0.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5S,6S)-5-amino-6-methyloxane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6S)-5-amino-6-methyloxane-2,5-diol?
The IUPAC name of (5S,6S)-5-amino-6-methyloxane-2,5-diol (CID 90818771) is (5S,6S)-5-amino-6-methyloxane-2,5-diol.
What is the SMILES notation for (5S,6S)-5-amino-6-methyloxane-2,5-diol?
The canonical SMILES for (5S,6S)-5-amino-6-methyloxane-2,5-diol is C[C@@H]1OC(O)CC[C@]1(N)O.
What is the InChIKey of (5S,6S)-5-amino-6-methyloxane-2,5-diol?
The InChIKey is UXELRRQCHHMYJQ-BZWZBFKDSA-N. The full InChI is InChI=1S/C6H13NO3/c1-4-6(7,9)3-2-5(8)10-4/h4-5,8-9H,2-3,7H2,1H3/t4-,5?,6-/m0/s1.
What are the key properties of (5S,6S)-5-amino-6-methyloxane-2,5-diol?
(5S,6S)-5-amino-6-methyloxane-2,5-diol has a molecular weight of 147.17 g/mol, XLogP of -0.85, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6S)-5-amino-6-methyloxane-2,5-diol is sourced from PubChem (CID 90818771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).