About sulfur trioxide;trimethyl(trifluoromethyl)silane
sulfur trioxide;trimethyl(trifluoromethyl)silane (PubChem CID 90819170) has the molecular formula C4H9F3O3SSi
and a molecular weight of 222.26 g/mol. Its IUPAC name is sulfur trioxide;trimethyl(trifluoromethyl)silane.
Molecular Properties
| Compound Name | sulfur trioxide;trimethyl(trifluoromethyl)silane |
| PubChem CID | 90819170 |
| Molecular Formula | C4H9F3O3SSi |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | sulfur trioxide;trimethyl(trifluoromethyl)silane |
| SMILES | C[Si](C)(C)C(F)(F)F.O=S(=O)=O |
| InChI | InChI=1S/C4H9F3Si.O3S/c1-8(2,3)4(5,6)7;1-4(2)3/h1-3H3; |
| InChIKey | KPUSXBYWBVPPGJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sulfur trioxide;trimethyl(trifluoromethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfur trioxide;trimethyl(trifluoromethyl)silane?
The IUPAC name of sulfur trioxide;trimethyl(trifluoromethyl)silane (CID 90819170) is sulfur trioxide;trimethyl(trifluoromethyl)silane.
What is the SMILES notation for sulfur trioxide;trimethyl(trifluoromethyl)silane?
The canonical SMILES for sulfur trioxide;trimethyl(trifluoromethyl)silane is C[Si](C)(C)C(F)(F)F.O=S(=O)=O.
What is the InChIKey of sulfur trioxide;trimethyl(trifluoromethyl)silane?
The InChIKey is KPUSXBYWBVPPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F3Si.O3S/c1-8(2,3)4(5,6)7;1-4(2)3/h1-3H3;.
What are the key properties of sulfur trioxide;trimethyl(trifluoromethyl)silane?
sulfur trioxide;trimethyl(trifluoromethyl)silane has a molecular weight of 222.26 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfur trioxide;trimethyl(trifluoromethyl)silane is sourced from PubChem (CID 90819170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).