sulfur trioxide;trimethyl(trifluoromethyl)silane

C4H9F3O3SSi — CID 90819170

IUPACsulfur trioxide;trimethyl(trifluoromethyl)silane
SMILESC[Si](C)(C)C(F)(F)F.O=S(=O)=O
InChIInChI=1S/C4H9F3Si.O3S/c1-8(2,3)4(5,6)7;1-4(2)3/h1-3H3;
InChIKeyKPUSXBYWBVPPGJ-UHFFFAOYSA-N
MW222.26 g/mol
LogP1.42
Rot. Bonds

About sulfur trioxide;trimethyl(trifluoromethyl)silane

sulfur trioxide;trimethyl(trifluoromethyl)silane (PubChem CID 90819170) has the molecular formula C4H9F3O3SSi and a molecular weight of 222.26 g/mol. Its IUPAC name is sulfur trioxide;trimethyl(trifluoromethyl)silane.

Molecular Properties

Compound Namesulfur trioxide;trimethyl(trifluoromethyl)silane
PubChem CID90819170
Molecular FormulaC4H9F3O3SSi
Molecular Weight222.26 g/mol
Exact Mass222.00
IUPAC Namesulfur trioxide;trimethyl(trifluoromethyl)silane
SMILESC[Si](C)(C)C(F)(F)F.O=S(=O)=O
InChIInChI=1S/C4H9F3Si.O3S/c1-8(2,3)4(5,6)7;1-4(2)3/h1-3H3;
InChIKeyKPUSXBYWBVPPGJ-UHFFFAOYSA-N
XLogP1.42
TPSA51.21 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.26
LogP ≤ 51.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze sulfur trioxide;trimethyl(trifluoromethyl)silane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfur trioxide;trimethyl(trifluoromethyl)silane?
The IUPAC name of sulfur trioxide;trimethyl(trifluoromethyl)silane (CID 90819170) is sulfur trioxide;trimethyl(trifluoromethyl)silane.
What is the SMILES notation for sulfur trioxide;trimethyl(trifluoromethyl)silane?
The canonical SMILES for sulfur trioxide;trimethyl(trifluoromethyl)silane is C[Si](C)(C)C(F)(F)F.O=S(=O)=O.
What is the InChIKey of sulfur trioxide;trimethyl(trifluoromethyl)silane?
The InChIKey is KPUSXBYWBVPPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F3Si.O3S/c1-8(2,3)4(5,6)7;1-4(2)3/h1-3H3;.
What are the key properties of sulfur trioxide;trimethyl(trifluoromethyl)silane?
sulfur trioxide;trimethyl(trifluoromethyl)silane has a molecular weight of 222.26 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfur trioxide;trimethyl(trifluoromethyl)silane is sourced from PubChem (CID 90819170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).