C27H27F2N3O4S — CID 90819197
3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-N,N-dimethylbenzamide (PubChem CID 90819197) has the molecular formula C27H27F2N3O4S and a molecular weight of 527.59 g/mol. Its IUPAC name is 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 90819197 |
| Molecular Formula | C27H27F2N3O4S |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 3-[[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(S(=O)(=O)N2CC=C(NOC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C27H27F2N3O4S/c1-31(2)27(33)21-4-3-5-25(18-21)37(34,35)32-16-14-24(15-17-32)30-36-26(19-6-10-22(28)11-7-19)20-8-12-23(29)13-9-20/h3-14,18,26,30H,15-17H2,1-2H3 |
| InChIKey | DDLBUJSQCRVWBK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|