About undeca-5,8-dienoic acid
undeca-5,8-dienoic acid (PubChem CID 90819284) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is undeca-5,8-dienoic acid.
Molecular Properties
| Compound Name | undeca-5,8-dienoic acid |
| PubChem CID | 90819284 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | undeca-5,8-dienoic acid |
| SMILES | CCC=CCC=CCCCC(=O)O |
| InChI | InChI=1S/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h3-4,6-7H,2,5,8-10H2,1H3,(H,12,13) |
| InChIKey | GMXPWUDCZWPMBL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze undeca-5,8-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undeca-5,8-dienoic acid?
The IUPAC name of undeca-5,8-dienoic acid (CID 90819284) is undeca-5,8-dienoic acid.
What is the SMILES notation for undeca-5,8-dienoic acid?
The canonical SMILES for undeca-5,8-dienoic acid is CCC=CCC=CCCCC(=O)O.
What is the InChIKey of undeca-5,8-dienoic acid?
The InChIKey is GMXPWUDCZWPMBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h3-4,6-7H,2,5,8-10H2,1H3,(H,12,13).
What are the key properties of undeca-5,8-dienoic acid?
undeca-5,8-dienoic acid has a molecular weight of 182.26 g/mol, XLogP of 3.15, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undeca-5,8-dienoic acid is sourced from PubChem (CID 90819284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).