About ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine
ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine (PubChem CID 90819516) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine.
Molecular Properties
| Compound Name | ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine |
| PubChem CID | 90819516 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine |
| SMILES | CC.CC1(N)CCC2(CC1)OCCCO2 |
| InChI | InChI=1S/C10H19NO2.C2H6/c1-9(11)3-5-10(6-4-9)12-7-2-8-13-10;1-2/h2-8,11H2,1H3;1-2H3 |
| InChIKey | JHEPGCQPGMOAJT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine?
The IUPAC name of ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine (CID 90819516) is ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine.
What is the SMILES notation for ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine?
The canonical SMILES for ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine is CC.CC1(N)CCC2(CC1)OCCCO2.
What is the InChIKey of ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine?
The InChIKey is JHEPGCQPGMOAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.C2H6/c1-9(11)3-5-10(6-4-9)12-7-2-8-13-10;1-2/h2-8,11H2,1H3;1-2H3.
What are the key properties of ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine?
ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine has a molecular weight of 215.34 g/mol, XLogP of 2.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine is sourced from PubChem (CID 90819516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).