C10H14N2 — CID 90820488
6-ethenyl-2,3,5,6,7,8-hexahydroquinoxaline (PubChem CID 90820488) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 6-ethenyl-2,3,5,6,7,8-hexahydroquinoxaline.
| Compound Name | 6-ethenyl-2,3,5,6,7,8-hexahydroquinoxaline |
|---|---|
| PubChem CID | 90820488 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 6-ethenyl-2,3,5,6,7,8-hexahydroquinoxaline |
| SMILES | C=CC1CCC2=NCCN=C2C1 |
| InChI | InChI=1S/C10H14N2/c1-2-8-3-4-9-10(7-8)12-6-5-11-9/h2,8H,1,3-7H2 |
| InChIKey | ZNQARNNXLHMSFU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|