C10H14N5O3+ — CID 90820640
1,6-dimethyl-4-oxo-3-propan-2-yl-8H-pyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione (PubChem CID 90820640) has the molecular formula C10H14N5O3+ and a molecular weight of 252.25 g/mol. Its IUPAC name is 1,6-dimethyl-4-oxo-3-propan-2-yl-8H-pyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione.
| Compound Name | 1,6-dimethyl-4-oxo-3-propan-2-yl-8H-pyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione |
|---|---|
| PubChem CID | 90820640 |
| Molecular Formula | C10H14N5O3+ |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1,6-dimethyl-4-oxo-3-propan-2-yl-8H-pyrimido[5,4-e][1,2,4]triazin-4-ium-5,7-dione |
| SMILES | CC(C)c1nn(C)c2[nH]c(=O)n(C)c(=O)c2[n+]1=O |
| InChI | InChI=1S/C10H13N5O3/c1-5(2)7-12-14(4)8-6(15(7)18)9(16)13(3)10(17)11-8/h5H,1-4H3/p+1 |
| InChIKey | JSFMRVLADNMKDO-UHFFFAOYSA-O |
| XLogP | -1.00 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|