C54H44N4 — CID 90820703
5,15-bis(3-ethynylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 90820703) has the molecular formula C54H44N4 and a molecular weight of 748.97 g/mol. Its IUPAC name is 5,15-bis(3-ethynylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,15-bis(3-ethynylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90820703 |
| Molecular Formula | C54H44N4 |
| Molecular Weight | 748.97 g/mol |
| Exact Mass | 748.36 |
| IUPAC Name | 5,15-bis(3-ethynylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | C#Cc1cccc(C2=c3ccc([nH]3)=C(c3c(C)cc(C)cc3C)c3ccc([nH]3)C(c3cccc(C#C)c3)=c3ccc([nH]3)=C(c3c(C)cc(C)cc3C)c3ccc2[nH]3)c1 |
| InChI | InChI=1S/C54H44N4/c1-9-37-13-11-15-39(29-37)51-41-17-21-45(55-41)53(49-33(5)25-31(3)26-34(49)6)47-23-19-43(57-47)52(40-16-12-14-38(10-2)30-40)44-20-24-48(58-44)54(46-22-18-42(51)56-46)50-35(7)27-32(4)28-36(50)8/h1-2,11-30,55-58H,3-8H3 |
| InChIKey | UZTVFGRBEAMZIY-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.97 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|