C45H74N2 — CID 90820810
(Z)-N-[2,3-dimethyl-3-(6-methyl-5-propylcyclohepta-1,3,6-trien-1-yl)butan-2-yl]-2-ethylidene-N-methyl-6-[5-[3-(6-methylcyclohex-2-en-1-yl)propyl]cyclooctyl]iminohept-3-en-1-amine (PubChem CID 90820810) has the molecular formula C45H74N2 and a molecular weight of 643.10 g/mol. Its IUPAC name is (Z)-N-[2,3-dimethyl-3-(6-methyl-5-propylcyclohepta-1,3,6-trien-1-yl)butan-2-yl]-2-ethylidene-N-methyl-6-[5-[3-(6-methylcyclohex-2-en-1-yl)propyl]cyclooctyl]iminohept-3-en-1-amine.
| Compound Name | (Z)-N-[2,3-dimethyl-3-(6-methyl-5-propylcyclohepta-1,3,6-trien-1-yl)butan-2-yl]-2-ethylidene-N-methyl-6-[5-[3-(6-methylcyclohex-2-en-1-yl)propyl]cyclooctyl]iminohept-3-en-1-amine |
|---|---|
| PubChem CID | 90820810 |
| Molecular Formula | C45H74N2 |
| Molecular Weight | 643.10 g/mol |
| Exact Mass | 642.59 |
| IUPAC Name | (Z)-N-[2,3-dimethyl-3-(6-methyl-5-propylcyclohepta-1,3,6-trien-1-yl)butan-2-yl]-2-ethylidene-N-methyl-6-[5-[3-(6-methylcyclohex-2-en-1-yl)propyl]cyclooctyl]iminohept-3-en-1-amine |
| SMILES | CC=C(/C=C\C/C(C)=N/C1CCCC(CCCC2C=CCCC2C)CCC1)CN(C)C(C)(C)C(C)(C)C1=CC=CC(CCC)C(C)=C1 |
| InChI | InChI=1S/C45H74N2/c1-11-20-40-29-19-30-42(33-36(40)4)44(6,7)45(8,9)47(10)34-38(12-2)23-15-22-37(5)46-43-31-17-25-39(26-18-32-43)24-16-28-41-27-14-13-21-35(41)3/h12,14-15,19,23,27,29-30,33,35,39-41,43H,11,13,16-18,20-22,24-26,28,31-32,34H2,1-10H3/b23-15-,38-12?,46-37+ |
| InChIKey | XCIFVGMEVWBVOQ-RBPNMRDHSA-N |
| XLogP | 13.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.10 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|