C18H20FN3O3S — CID 90821287
3-[2-[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]ethoxy]-1,2-oxazole (PubChem CID 90821287) has the molecular formula C18H20FN3O3S and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-[2-[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]ethoxy]-1,2-oxazole.
| Compound Name | 3-[2-[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]ethoxy]-1,2-oxazole |
|---|---|
| PubChem CID | 90821287 |
| Molecular Formula | C18H20FN3O3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-[2-[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]ethoxy]-1,2-oxazole |
| SMILES | Fc1cc(C2=CC(CCOc3ccon3)ON2)ccc1N1CCSCC1 |
| InChI | InChI=1S/C18H20FN3O3S/c19-15-11-13(1-2-17(15)22-5-9-26-10-6-22)16-12-14(25-20-16)3-7-23-18-4-8-24-21-18/h1-2,4,8,11-12,14,20H,3,5-7,9-10H2 |
| InChIKey | CRSQUFQBQPSALS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|