C22H16F3NO2 — CID 90821580
2-[[4-[4-(trifluoromethyl)phenoxy]phenyl]methyl]isoindol-1-ol (PubChem CID 90821580) has the molecular formula C22H16F3NO2 and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-[[4-[4-(trifluoromethyl)phenoxy]phenyl]methyl]isoindol-1-ol.
| Compound Name | 2-[[4-[4-(trifluoromethyl)phenoxy]phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90821580 |
| Molecular Formula | C22H16F3NO2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[[4-[4-(trifluoromethyl)phenoxy]phenyl]methyl]isoindol-1-ol |
| SMILES | Oc1c2ccccc2cn1Cc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H16F3NO2/c23-22(24,25)17-7-11-19(12-8-17)28-18-9-5-15(6-10-18)13-26-14-16-3-1-2-4-20(16)21(26)27/h1-12,14,27H,13H2 |
| InChIKey | FDGZXXFRMVJIIM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |