About dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane
dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane (PubChem CID 90821585) has the molecular formula C30H41O6P
and a molecular weight of 528.63 g/mol. Its IUPAC name is dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane.
Molecular Properties
| Compound Name | dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane |
| PubChem CID | 90821585 |
| Molecular Formula | C30H41O6P |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane |
| SMILES | CCCP=O.Cc1ccc(O)cc1.O=C(OC1CCCCC1)c1ccccc1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C20H26O4.C7H8O.C3H7OP/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16;1-6-2-4-7(8)5-3-6;1-2-3-5-4/h7-8,13-16H,1-6,9-12H2;2-5,8H,1H3;2-3H2,1H3 |
| InChIKey | LEELLBKOHSINPP-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane?
The IUPAC name of dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane (CID 90821585) is dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane.
What is the SMILES notation for dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane?
The canonical SMILES for dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane is CCCP=O.Cc1ccc(O)cc1.O=C(OC1CCCCC1)c1ccccc1C(=O)OC1CCCCC1.
What is the InChIKey of dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane?
The InChIKey is LEELLBKOHSINPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O4.C7H8O.C3H7OP/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16;1-6-2-4-7(8)5-3-6;1-2-3-5-4/h7-8,13-16H,1-6,9-12H2;2-5,8H,1H3;2-3H2,1H3.
What are the key properties of dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane?
dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane has a molecular weight of 528.63 g/mol, XLogP of 8.05, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl benzene-1,2-dicarboxylate;4-methylphenol;1-phosphorosopropane is sourced from PubChem (CID 90821585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).