About 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid
2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid (PubChem CID 90822823) has the molecular formula C16H14O4S2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid.
Molecular Properties
| Compound Name | 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid |
| PubChem CID | 90822823 |
| Molecular Formula | C16H14O4S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid |
| SMILES | CC=S(Sc1ccccc1C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H14O4S2/c1-2-22(14-10-6-4-8-12(14)16(19)20)21-13-9-5-3-7-11(13)15(17)18/h2-10H,1H3,(H,17,18)(H,19,20) |
| InChIKey | PTTRZIPZUZYKNJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid?
The IUPAC name of 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid (CID 90822823) is 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid.
What is the SMILES notation for 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid?
The canonical SMILES for 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid is CC=S(Sc1ccccc1C(=O)O)c1ccccc1C(=O)O.
What is the InChIKey of 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid?
The InChIKey is PTTRZIPZUZYKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4S2/c1-2-22(14-10-6-4-8-12(14)16(19)20)21-13-9-5-3-7-11(13)15(17)18/h2-10H,1H3,(H,17,18)(H,19,20).
What are the key properties of 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid?
2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid has a molecular weight of 334.42 g/mol, XLogP of 4.24, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-carboxyphenyl)-ethylidene-λ4-sulfanyl]sulfanylbenzoic acid is sourced from PubChem (CID 90822823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).