C25H37N3O4 — CID 90823052
N-(1-acetamido-2-methyl-1-oxopropan-2-yl)-1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide (PubChem CID 90823052) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-(1-acetamido-2-methyl-1-oxopropan-2-yl)-1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide.
| Compound Name | N-(1-acetamido-2-methyl-1-oxopropan-2-yl)-1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90823052 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | N-(1-acetamido-2-methyl-1-oxopropan-2-yl)-1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
| SMILES | CC(=O)NC(=O)C(C)(C)NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C25H37N3O4/c1-17(29)26-24(32)25(2,3)27-22(30)20-15-19-13-9-4-5-10-14-21(19)28(23(20)31)16-18-11-7-6-8-12-18/h15,18H,4-14,16H2,1-3H3,(H,27,30)(H,26,29,32) |
| InChIKey | RCCJHJDWNJVHJG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |