C21H26F6O — CID 90823290
2-[4-[1-(2-tert-butylcyclopropen-1-yl)-2,2-dimethylpropyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 90823290) has the molecular formula C21H26F6O and a molecular weight of 408.43 g/mol. Its IUPAC name is 2-[4-[1-(2-tert-butylcyclopropen-1-yl)-2,2-dimethylpropyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[1-(2-tert-butylcyclopropen-1-yl)-2,2-dimethylpropyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 90823290 |
| Molecular Formula | C21H26F6O |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-[4-[1-(2-tert-butylcyclopropen-1-yl)-2,2-dimethylpropyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(C)(C)C1=C(C(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H26F6O/c1-17(2,3)15-11-14(15)16(18(4,5)6)12-7-9-13(10-8-12)19(28,20(22,23)24)21(25,26)27/h7-10,16,28H,11H2,1-6H3 |
| InChIKey | CNZNEQVAZZLMHE-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|