C26H37FN3O8P — CID 90823455
[2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate (PubChem CID 90823455) has the molecular formula C26H37FN3O8P and a molecular weight of 569.57 g/mol. Its IUPAC name is [2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate.
| Compound Name | [2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90823455 |
| Molecular Formula | C26H37FN3O8P |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | [2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-1,3,6-trihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1Cc2c(c(O)n(CCCN3CCN(c4cc(F)ccc4OC4CCCC4)CC3)c2O)CC1O |
| InChI | InChI=1S/C26H37FN3O8P/c27-17-6-7-23(37-18-4-1-2-5-18)21(14-17)29-12-10-28(11-13-29)8-3-9-30-25(32)19-15-22(31)24(38-39(34,35)36)16-20(19)26(30)33/h6-7,14,18,22,24,31-33H,1-5,8-13,15-16H2,(H2,34,35,36) |
| InChIKey | WXQJHHRJEKTRED-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 148.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|