C22H38N2O4 — CID 90823572
(4S)-4-[[(2S)-2-(cyclohexanecarbonylamino)-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 90823572) has the molecular formula C22H38N2O4 and a molecular weight of 394.56 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-(cyclohexanecarbonylamino)-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (4S)-4-[[(2S)-2-(cyclohexanecarbonylamino)-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 90823572 |
| Molecular Formula | C22H38N2O4 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | (4S)-4-[[(2S)-2-(cyclohexanecarbonylamino)-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CC(=C[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)C1CCCCC1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C22H38N2O4/c1-14(2)17(13-15(3)21(27)28)24(7)20(26)18(22(4,5)6)23-19(25)16-11-9-8-10-12-16/h13-14,16-18H,8-12H2,1-7H3,(H,23,25)(H,27,28)/t17-,18-/m1/s1 |
| InChIKey | OEOQIUNRSXDNLL-QZTJIDSGSA-N |
| XLogP | 3.61 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|