About deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol
deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol (PubChem CID 90823579) has the molecular formula C15H35NO3S
and a molecular weight of 310.52 g/mol. Its IUPAC name is deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol.
Molecular Properties
| Compound Name | deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol |
| PubChem CID | 90823579 |
| Molecular Formula | C15H35NO3S |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol |
| SMILES | CC.CCS(=O)(=O)CCN1CCC(C(C)(C)O)CC1.[2H]C |
| InChI | InChI=1S/C12H25NO3S.C2H6.CH4/c1-4-17(15,16)10-9-13-7-5-11(6-8-13)12(2,3)14;1-2;/h11,14H,4-10H2,1-3H3;1-2H3;1H4/i;;1D |
| InChIKey | FRRKYGLARGQYRT-PRQZKWGPSA-N |
| XLogP | 2.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol?
The IUPAC name of deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol (CID 90823579) is deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol.
What is the SMILES notation for deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol?
The canonical SMILES for deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol is CC.CCS(=O)(=O)CCN1CCC(C(C)(C)O)CC1.[2H]C.
What is the InChIKey of deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol?
The InChIKey is FRRKYGLARGQYRT-PRQZKWGPSA-N. The full InChI is InChI=1S/C12H25NO3S.C2H6.CH4/c1-4-17(15,16)10-9-13-7-5-11(6-8-13)12(2,3)14;1-2;/h11,14H,4-10H2,1-3H3;1-2H3;1H4/i;;1D.
What are the key properties of deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol?
deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol has a molecular weight of 310.52 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethane;ethane;2-[1-(2-ethylsulfonylethyl)piperidin-4-yl]propan-2-ol is sourced from PubChem (CID 90823579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).